Products 1552-94-9
CAS 1552-94-9 appears in our catalog under these names: 5-Phenylpenta-2,4-dienoic acid, 98%, Cinnamylideneacetic acid/ 99.75% (existing batch purity), Cinnamylideneacetic acid/ 98+%, 5-Phenyl-2,4-pentadienoic acid, 98+% , 5-Phenylpenta-2,4-dienoic acid. Offered by: Combi-blocks, TargetMol, Chemat, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 10g, 100g, 5g, 25g, 1g, 100mg, 500mg, 250g.
5-phenylpenta-2,4-dienoic acid (CAS 1552-94-9) is a chemical compound with the molecular formula C11H10O2 and a molecular weight of 174.20 g/mol. IUPAC name: 5-phenylpenta-2,4-dienoic acid. InChIKey: FEIQOMCWGDNMHM-UHFFFAOYSA-N.
| Molecular formula | C11H10O2 |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | 5-phenylpenta-2,4-dienoic acid |
| InChIKey | FEIQOMCWGDNMHM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C=CC=CC(=O)O |
Computed by PubChem (NCBI)