CAS 51213-99-1 appears in our catalog under these names: Clanfenur, Clanfenur/ 99.89% (existing batch purity), N-((4-Chlorophenyl)carbamoyl)-2-(dimethylamino)-6-fluorobenzamide, 98%, 98%, Clanfenur, 99.53%, CLANFENUR, 98%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 100 mg.
N-[(4-chlorophenyl)carbamoyl]-2-(dimethylamino)-6-fluorobenzamide (CAS 51213-99-1) is a chemical compound with the molecular formula C16H15ClFN3O2 and a molecular weight of 335.76 g/mol. IUPAC name: N-[(4-chlorophenyl)carbamoyl]-2-(dimethylamino)-6-fluorobenzamide. InChIKey: SRLPZQAEBMZCIJ-UHFFFAOYSA-N.
| Molecular formula | C16H15ClFN3O2 |
|---|---|
| Molecular weight | 335.76 g/mol |
| IUPAC name | N-[(4-chlorophenyl)carbamoyl]-2-(dimethylamino)-6-fluorobenzamide |
| InChIKey | SRLPZQAEBMZCIJ-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C(=CC=C1)F)C(=O)NC(=O)NC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)