cas: 92953-10-1 — see every product listed under this CAS number, including other names
Clofilium tosylate, 95%, 95% (CAS 92953-10-1) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1145MF-25mg |
| cas | 92953-10-1 |
| size | 25mg |
| availability | 0.1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 563.60 Pln | |
| Chemat | 50mg | 952.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-(4-chlorophenyl)butyl-diethyl-heptylazanium;4-methylbenzenesulfonate (CAS 92953-10-1) is a chemical compound with the molecular formula C28H44ClNO3S and a molecular weight of 510.2 g/mol. IUPAC name: 4-(4-chlorophenyl)butyl-diethyl-heptylazanium;4-methylbenzenesulfonate. InChIKey: MOQZYUUHIWPDQC-UHFFFAOYSA-M.
| Molecular formula | C28H44ClNO3S |
|---|---|
| Molecular weight | 510.2 g/mol |
| IUPAC name | 4-(4-chlorophenyl)butyl-diethyl-heptylazanium;4-methylbenzenesulfonate |
| InChIKey | MOQZYUUHIWPDQC-UHFFFAOYSA-M |
| SMILES | CCCCCCC[N+](CC)(CC)CCCCC1=CC=C(C=C1)Cl.CC1=CC=C(C=C1)S(=O)(=O)[O-] |
Computed by PubChem (NCBI)