CAS 92953-10-1 appears in our catalog under these names: Clofilium tosylate, Clofilium tosylate, 95%, Clofilium Tosylate, Clofilium tosylate/ 99.68% (existing batch purity), Clofilium tosylate 97%. Offered by: GLPBio, Combi-blocks, TRC, TargetMol, Ambeed. Available pack sizes: 10mg, 1mg, 250mg, 1g, 2mg, 5mg, 25mg, 50mg.
4-(4-chlorophenyl)butyl-diethyl-heptylazanium;4-methylbenzenesulfonate (CAS 92953-10-1) is a chemical compound with the molecular formula C28H44ClNO3S and a molecular weight of 510.2 g/mol. IUPAC name: 4-(4-chlorophenyl)butyl-diethyl-heptylazanium;4-methylbenzenesulfonate. InChIKey: MOQZYUUHIWPDQC-UHFFFAOYSA-M.
| Molecular formula | C28H44ClNO3S |
|---|---|
| Molecular weight | 510.2 g/mol |
| IUPAC name | 4-(4-chlorophenyl)butyl-diethyl-heptylazanium;4-methylbenzenesulfonate |
| InChIKey | MOQZYUUHIWPDQC-UHFFFAOYSA-M |
| SMILES | CCCCCCC[N+](CC)(CC)CCCCC1=CC=C(C=C1)Cl.CC1=CC=C(C=C1)S(=O)(=O)[O-] |
Computed by PubChem (NCBI)