CAS 85409-44-5 appears in our catalog under these names: Cloponone, Cloponone 100 µg/mL in Acetonitrile. Offered by: Dr. Ehrenstorfer. Available pack sizes: 50mg, 1ml.
2,2-dichloro-N-[3-chloro-1-(4-chlorophenyl)-1-oxopropan-2-yl]acetamide (CAS 85409-44-5) is a chemical compound with the molecular formula C11H9Cl4NO2 and a molecular weight of 329.0 g/mol. IUPAC name: 2,2-dichloro-N-[3-chloro-1-(4-chlorophenyl)-1-oxopropan-2-yl]acetamide. InChIKey: MLVKMSCFQIQULM-UHFFFAOYSA-N.
| Molecular formula | C11H9Cl4NO2 |
|---|---|
| Molecular weight | 329.0 g/mol |
| IUPAC name | 2,2-dichloro-N-[3-chloro-1-(4-chlorophenyl)-1-oxopropan-2-yl]acetamide |
| InChIKey | MLVKMSCFQIQULM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C(CCl)NC(=O)C(Cl)Cl)Cl |
Computed by PubChem (NCBI)