CAS 55695-56-2 appears in our catalog under these names: Cloroperone hydrochloride/ 98.56% (existing batch purity), AHR-6134. Offered by: TargetMol, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg.
4-[4-(4-chlorobenzoyl)piperidin-1-yl]-1-(4-fluorophenyl)butan-1-one;hydrochloride (CAS 55695-56-2) is a chemical compound with the molecular formula C22H24Cl2FNO2 and a molecular weight of 424.3 g/mol. IUPAC name: 4-[4-(4-chlorobenzoyl)piperidin-1-yl]-1-(4-fluorophenyl)butan-1-one;hydrochloride. InChIKey: ZIJIVCQJKDRJOL-UHFFFAOYSA-N.
| Molecular formula | C22H24Cl2FNO2 |
|---|---|
| Molecular weight | 424.3 g/mol |
| IUPAC name | 4-[4-(4-chlorobenzoyl)piperidin-1-yl]-1-(4-fluorophenyl)butan-1-one;hydrochloride |
| InChIKey | ZIJIVCQJKDRJOL-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C(=O)C2=CC=C(C=C2)Cl)CCCC(=O)C3=CC=C(C=C3)F.Cl |
Computed by PubChem (NCBI)