cas: 546-97-4 — see every product listed under this CAS number, including other names
Columbin, ≥98%, ≥98% (CAS 546-97-4) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DA69-1mg |
| cas | 546-97-4 |
| size | 1mg |
| availability | 0.2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 117.20 Pln | |
| Chemat | 5mg | 242.00 Pln | |
| Chemat | 10mg | 342.80 Pln | |
| Chemat | 25mg | 746.00 Pln | |
| Chemat | 100mg | 1355.60 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
(1S,2S,3S,5S,8R,11R,12S)-5-(furan-3-yl)-12-hydroxy-3,11-dimethyl-6,14-dioxatetracyclo[10.2.2.02,11.03,8]hexadec-15-ene-7,13-dione (CAS 546-97-4) is a chemical compound with the molecular formula C20H22O6 and a molecular weight of 358.4 g/mol. IUPAC name: (1S,2S,3S,5S,8R,11R,12S)-5-(furan-3-yl)-12-hydroxy-3,11-dimethyl-6,14-dioxatetracyclo[10.2.2.02,11.03,8]hexadec-15-ene-7,13-dione. InChIKey: AALLCALQGXXWNA-DURQJQQASA-N.
| Molecular formula | C20H22O6 |
|---|---|
| Molecular weight | 358.4 g/mol |
| IUPAC name | (1S,2S,3S,5S,8R,11R,12S)-5-(furan-3-yl)-12-hydroxy-3,11-dimethyl-6,14-dioxatetracyclo[10.2.2.02,11.03,8]hexadec-15-ene-7,13-dione |
| InChIKey | AALLCALQGXXWNA-DURQJQQASA-N |
| SMILES | C[C@@]12CC[C@H]3C(=O)O[C@@H](C[C@]3([C@@H]1[C@@H]4C=C[C@]2(C(=O)O4)O)C)C5=COC=C5 |
Computed by PubChem (NCBI)