CAS 70938-60-2 appears in our catalog under these names: Comanthoside B, Comanthoside B/ 99.66% (existing batch purity), Comanthoside B, Comanthoside B, 98.09%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 50mg, 25mg, 10mg, 1 mg, 5 mg.
(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[5-hydroxy-6-methoxy-2-(4-methoxyphenyl)-4-oxochromen-7-yl]oxyoxane-2-carboxylic acid (CAS 70938-60-2) is a chemical compound with the molecular formula C23H22O12 and a molecular weight of 490.4 g/mol. IUPAC name: (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[5-hydroxy-6-methoxy-2-(4-methoxyphenyl)-4-oxochromen-7-yl]oxyoxane-2-carboxylic acid. InChIKey: ZEKXCIHGJAZTEW-VLXBDIDVSA-N.
| Molecular formula | C23H22O12 |
|---|---|
| Molecular weight | 490.4 g/mol |
| IUPAC name | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[5-hydroxy-6-methoxy-2-(4-methoxyphenyl)-4-oxochromen-7-yl]oxyoxane-2-carboxylic acid |
| InChIKey | ZEKXCIHGJAZTEW-VLXBDIDVSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC(=O)C3=C(C(=C(C=C3O2)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)C(=O)O)O)O)O)OC)O |
Computed by PubChem (NCBI)