Products 2365402-67-9
CAS 2365402-67-9 appears in our catalog under these names: Complement C5-IN-1/ 99.2% (existing batch purity), Complement C5-IN-1, Complement C5-IN-1, 99.14%. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 1 mg.
5-methoxy-2-[[(1S)-1-(2-methoxyphenyl)ethyl]carbamoylamino]-4-(4-methylpentoxy)benzoic acid (CAS 2365402-67-9) is a chemical compound with the molecular formula C24H32N2O6 and a molecular weight of 444.5 g/mol. IUPAC name: 5-methoxy-2-[[(1S)-1-(2-methoxyphenyl)ethyl]carbamoylamino]-4-(4-methylpentoxy)benzoic acid. InChIKey: UFAFCKVYKJIJTR-INIZCTEOSA-N.
| Molecular formula | C24H32N2O6 |
|---|---|
| Molecular weight | 444.5 g/mol |
| IUPAC name | 5-methoxy-2-[[(1S)-1-(2-methoxyphenyl)ethyl]carbamoylamino]-4-(4-methylpentoxy)benzoic acid |
| InChIKey | UFAFCKVYKJIJTR-INIZCTEOSA-N |
| SMILES | C[C@@H](C1=CC=CC=C1OC)NC(=O)NC2=CC(=C(C=C2C(=O)O)OC)OCCCC(C)C |
Computed by PubChem (NCBI)