cas: 1011257-42-3 — see every product listed under this CAS number, including other names
Copper (I) diphenylphosphinate, 90%, 90% (CAS 1011257-42-3) is a chemical reagent available from Chemat. Available pack sizes: 100g, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1114SO-100g |
| cas | 1011257-42-3 |
| size | 100g |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100g | 4144.40 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 146.00 Pln | |
| Chemat | 5g | 419.60 Pln | |
| Chemat | 25g | 1336.40 Pln |
| purity | 90% |
|---|---|
| delivery time | 3 weeks |
Copper(1+);diphenylphosphinate (CAS 1011257-42-3) is a chemical compound with the molecular formula C12H10CuO2P and a molecular weight of 280.73 g/mol. IUPAC name: copper(1+);diphenylphosphinate. InChIKey: SVIKVYNAINDOJS-UHFFFAOYSA-M.
| Molecular formula | C12H10CuO2P |
|---|---|
| Molecular weight | 280.73 g/mol |
| IUPAC name | copper(1+);diphenylphosphinate |
| InChIKey | SVIKVYNAINDOJS-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)P(=O)(C2=CC=CC=C2)[O-].[Cu+] |
Computed by PubChem (NCBI)