cas: 1011257-42-3 — see every product listed under this CAS number, including other names
Copper(I) diphenylphosphinate 90% (CAS 1011257-42-3) is a chemical reagent available from Chemat. Available pack sizes: 100g, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A217969-100g |
| cas | 1011257-42-3 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 4091.69 Pln | |
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 437.12 Pln | |
| Ambeed | 25g | 1327.12 Pln |
| purity | 90% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A217969 |
Copper(1+);diphenylphosphinate (CAS 1011257-42-3) is a chemical compound with the molecular formula C12H10CuO2P and a molecular weight of 280.73 g/mol. IUPAC name: copper(1+);diphenylphosphinate. InChIKey: SVIKVYNAINDOJS-UHFFFAOYSA-M.
| Molecular formula | C12H10CuO2P |
|---|---|
| Molecular weight | 280.73 g/mol |
| IUPAC name | copper(1+);diphenylphosphinate |
| InChIKey | SVIKVYNAINDOJS-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)P(=O)(C2=CC=CC=C2)[O-].[Cu+] |
Computed by PubChem (NCBI)