Products 2365532-64-3
CAS 2365532-64-3 appears in our catalog under these names: Copper probe CF4/ 98.58% (existing batch purity), Copper Fluor–4, Copper Probe CF4, Copper Fluor-4, 98.44%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 25 mg, 5 mg.
9-[4-[[bis[2-(2-ethylsulfanylethylsulfanyl)ethyl]amino]methyl]-2-(trifluoromethyl)phenyl]-6-piperidin-1-ylxanthen-3-one (CAS 2365532-64-3) is a chemical compound with the molecular formula C38H47F3N2O2S4 and a molecular weight of 749.1 g/mol. IUPAC name: 9-[4-[[bis[2-(2-ethylsulfanylethylsulfanyl)ethyl]amino]methyl]-2-(trifluoromethyl)phenyl]-6-piperidin-1-ylxanthen-3-one. InChIKey: IWSHBHVMVNQFGF-UHFFFAOYSA-N.
| Molecular formula | C38H47F3N2O2S4 |
|---|---|
| Molecular weight | 749.1 g/mol |
| IUPAC name | 9-[4-[[bis[2-(2-ethylsulfanylethylsulfanyl)ethyl]amino]methyl]-2-(trifluoromethyl)phenyl]-6-piperidin-1-ylxanthen-3-one |
| InChIKey | IWSHBHVMVNQFGF-UHFFFAOYSA-N |
| SMILES | CCSCCSCCN(CCSCCSCC)CC1=CC(=C(C=C1)C2=C3C=CC(=O)C=C3OC4=C2C=CC(=C4)N5CCCCC5)C(F)(F)F |
Computed by PubChem (NCBI)