Cy5-DBCO 97%
cas: 1564286-24-3 — see every product listed under this CAS number, including other names
Cy5-DBCO 97% (CAS 1564286-24-3) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A756289-1mg |
| cas | 1564286-24-3 |
| size | 1mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 598.44 Pln | |
| Ambeed | 5mg | 859.88 Pln | |
| Ambeed | 10mg | 1338.25 Pln | |
| Ambeed | 25mg | 2473.00 Pln | |
| Ambeed | 50mg | 4147.31 Pln | |
| Ambeed | 100mg | 6984.19 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A756289 |
1-[6-[[3-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-3-oxopropyl]amino]-6-oxohexyl]-2-[(1E,3E,5E)-5-[3,3-dimethyl-5-sulfo-1-(3-sulfopropyl)indol-2-ylidene]penta-1,3-dienyl]-3,3-dimethylindol-1-ium-5-sulfonate (CAS 1564286-24-3) is a chemical compound with the molecular formula C52H56N4O11S3 and a molecular weight of 1009.2 g/mol. IUPAC name: 1-[6-[[3-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-3-oxopropyl]amino]-6-oxohexyl]-2-[(1E,3E,5E)-5-[3,3-dimethyl-5-sulfo-1-(3-sulfopropyl)indol-2-ylidene]penta-1,3-dienyl]-3,3-dimethylindol-1-ium-5-sulfonate. InChIKey: LQHUKJFMCCLWEL-UHFFFAOYSA-N.
| Molecular formula | C52H56N4O11S3 |
|---|---|
| Molecular weight | 1009.2 g/mol |
| IUPAC name | 1-[6-[[3-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-3-oxopropyl]amino]-6-oxohexyl]-2-[(1E,3E,5E)-5-[3,3-dimethyl-5-sulfo-1-(3-sulfopropyl)indol-2-ylidene]penta-1,3-dienyl]-3,3-dimethylindol-1-ium-5-sulfonate |
| InChIKey | LQHUKJFMCCLWEL-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=CC(=C2)S(=O)(=O)[O-])[N+](=C1/C=C/C=C/C=C/3\C(C4=C(N3CCCS(=O)(=O)O)C=CC(=C4)S(=O)(=O)O)(C)C)CCCCCC(=O)NCCC(=O)N5CC6=CC=CC=C6C#CC7=CC=CC=C75)C |
Computed by PubChem (NCBI)