DBCO-Sulfo-Cy5, 97%, 97%
cas: 1564286-24-3 — see every product listed under this CAS number, including other names
DBCO-Sulfo-Cy5, 97%, 97% (CAS 1564286-24-3) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HYDV-5mg |
| cas | 1564286-24-3 |
| size | 5mg |
| availability | 0.075g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 5mg | 539.60 Pln | |
| Chemat | 10mg | 827.60 Pln | |
| Chemat | 25mg | 1514.00 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-[6-[[3-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-3-oxopropyl]amino]-6-oxohexyl]-2-[(1E,3E,5E)-5-[3,3-dimethyl-5-sulfo-1-(3-sulfopropyl)indol-2-ylidene]penta-1,3-dienyl]-3,3-dimethylindol-1-ium-5-sulfonate (CAS 1564286-24-3) is a chemical compound with the molecular formula C52H56N4O11S3 and a molecular weight of 1009.2 g/mol. IUPAC name: 1-[6-[[3-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-3-oxopropyl]amino]-6-oxohexyl]-2-[(1E,3E,5E)-5-[3,3-dimethyl-5-sulfo-1-(3-sulfopropyl)indol-2-ylidene]penta-1,3-dienyl]-3,3-dimethylindol-1-ium-5-sulfonate. InChIKey: LQHUKJFMCCLWEL-UHFFFAOYSA-N.
| Molecular formula | C52H56N4O11S3 |
|---|---|
| Molecular weight | 1009.2 g/mol |
| IUPAC name | 1-[6-[[3-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-3-oxopropyl]amino]-6-oxohexyl]-2-[(1E,3E,5E)-5-[3,3-dimethyl-5-sulfo-1-(3-sulfopropyl)indol-2-ylidene]penta-1,3-dienyl]-3,3-dimethylindol-1-ium-5-sulfonate |
| InChIKey | LQHUKJFMCCLWEL-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=CC(=C2)S(=O)(=O)[O-])[N+](=C1/C=C/C=C/C=C/3\C(C4=C(N3CCCS(=O)(=O)O)C=CC(=C4)S(=O)(=O)O)(C)C)CCCCCC(=O)NCCC(=O)N5CC6=CC=CC=C6C#CC7=CC=CC=C75)C |
Computed by PubChem (NCBI)