Cyclohexanecarboxylic Anhydride, 95%, 95%
cas: 22651-87-2 — see every product listed under this CAS number, including other names
Cyclohexanecarboxylic Anhydride, 95%, 95% (CAS 22651-87-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C4CP-1g |
| cas | 22651-87-2 |
| size | 1g |
| availability | 44.75g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 174.80 Pln | |
| Chemat | 5g | 352.40 Pln | |
| Chemat | 10g | 630.80 Pln | |
| Chemat | 25g | 1307.60 Pln | |
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 112.40 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Cyclohexanecarbonyl cyclohexanecarboxylate (CAS 22651-87-2) is a chemical compound with the molecular formula C14H22O3 and a molecular weight of 238.32 g/mol. IUPAC name: cyclohexanecarbonyl cyclohexanecarboxylate. InChIKey: JOHUAELJNSBTGS-UHFFFAOYSA-N.
| Molecular formula | C14H22O3 |
|---|---|
| Molecular weight | 238.32 g/mol |
| IUPAC name | cyclohexanecarbonyl cyclohexanecarboxylate |
| InChIKey | JOHUAELJNSBTGS-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C(=O)OC(=O)C2CCCCC2 |
Computed by PubChem (NCBI)
Synonyms:
Cyclohexanecarboxylic anhydride, Cyclohexanecarboxylic acid anhydride, cyclohexanecarbonyl cyclohexanecarboxylate, Cyclohexanecarboxylic acid, anhydride, cyclohexanecarboxylicanhydride, Bis(cyclohexanecarboxylic)anhydride, cyclohexane carboxylic anhydride, Cyclohexanecarboxylic Anhydride >Cyclohexanecarboxylic acid, 1,1'-anhydride