CAS 56309-94-5 appears in our catalog under these names: Bicyclohexane–4,4'–dione Monoethylene Ketal, Bicyclohexane-4,4'-dione Monoethylene Ketal, >98.0%(GC), Bicyclohexane-4,4-dione Monoethylene Ketal 98%, Bicyclohexane-4,4-dione Monoethylene Ketal, 98%, 98%, 4-(1,4-Dioxaspiro[4.5]decan-8-yl)cyclohexanone, 97%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 500g, 5g, 25g, 10g.
4-(1,4-dioxaspiro[4.5]decan-8-yl)cyclohexan-1-one (CAS 56309-94-5) is a chemical compound with the molecular formula C14H22O3 and a molecular weight of 238.32 g/mol. IUPAC name: 4-(1,4-dioxaspiro[4.5]decan-8-yl)cyclohexan-1-one. InChIKey: ZNWLFTSPNBLXGL-UHFFFAOYSA-N.
| Molecular formula | C14H22O3 |
|---|---|
| Molecular weight | 238.32 g/mol |
| IUPAC name | 4-(1,4-dioxaspiro[4.5]decan-8-yl)cyclohexan-1-one |
| InChIKey | ZNWLFTSPNBLXGL-UHFFFAOYSA-N |
| SMILES | C1CC(=O)CCC1C2CCC3(CC2)OCCO3 |
Computed by PubChem (NCBI)