CAS 74829-95-1 appears in our catalog under these names: Cyclohexanesulfinic acid sodium salt, 95%, 95%, Cyclohexanesulfinic acid sodium salt, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
Sodium cyclohexanesulfinate (CAS 74829-95-1) is a chemical compound with the molecular formula C6H11NaO2S and a molecular weight of 170.21 g/mol. IUPAC name: sodium cyclohexanesulfinate. InChIKey: VKOSCBDFLPBMCB-UHFFFAOYSA-M.
| Molecular formula | C6H11NaO2S |
|---|---|
| Molecular weight | 170.21 g/mol |
| IUPAC name | sodium cyclohexanesulfinate |
| InChIKey | VKOSCBDFLPBMCB-UHFFFAOYSA-M |
| SMILES | C1CCC(CC1)S(=O)[O-].[Na+] |
Computed by PubChem (NCBI)