CAS 1504364-90-2 is the registry number for Sodium cyclopentylmethanesulfinate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Sodium cyclopentylmethanesulfinate (CAS 1504364-90-2) is a chemical compound with the molecular formula C6H11NaO2S and a molecular weight of 170.21 g/mol. IUPAC name: sodium cyclopentylmethanesulfinate. InChIKey: BKXPMPHNNJADHG-UHFFFAOYSA-M.
| Molecular formula | C6H11NaO2S |
|---|---|
| Molecular weight | 170.21 g/mol |
| IUPAC name | sodium cyclopentylmethanesulfinate |
| InChIKey | BKXPMPHNNJADHG-UHFFFAOYSA-M |
| SMILES | C1CCC(C1)CS(=O)[O-].[Na+] |
Computed by PubChem (NCBI)