cas: 912563-45-2 — see every product listed under this CAS number, including other names
Cyclopenta[c]pyrrole-2(1H)-carboxylic acid, hexahydro-5-hydroxy-, 1,1-dimethylethyl ester, (3aα,5β,6aα)-, 95%, 95% (CAS 912563-45-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IGK8-100mg |
| cas | 912563-45-2 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 150.80 Pln | |
| Chemat | 1g | 400.40 Pln | |
| Chemat | 5g | 1653.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (3aR,6aS)-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate (CAS 912563-45-2) is a chemical compound with the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. IUPAC name: tert-butyl (3aR,6aS)-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate. InChIKey: DIDQRACXWWEPDZ-ULKQDVFKSA-N.
| Molecular formula | C12H21NO3 |
|---|---|
| Molecular weight | 227.30 g/mol |
| IUPAC name | tert-butyl (3aR,6aS)-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate |
| InChIKey | DIDQRACXWWEPDZ-ULKQDVFKSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2CC(C[C@H]2C1)O |
Computed by PubChem (NCBI)