cas: 1616388-38-5 — see every product listed under this CAS number, including other names
Cyclopropyl(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5,6-dihydropyridin-1(2H)-yl)methanone, 98%, 98% (CAS 1616388-38-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112VR6-100mg |
| cas | 1616388-38-5 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 400.40 Pln | |
| Chemat | 250mg | 626.00 Pln | |
| Chemat | 1g | 1466.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Cyclopropyl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridin-1-yl]methanone (CAS 1616388-38-5) is a chemical compound with the molecular formula C15H24BNO3 and a molecular weight of 277.17 g/mol. IUPAC name: cyclopropyl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridin-1-yl]methanone. InChIKey: NYESTZADXNFZMS-UHFFFAOYSA-N.
| Molecular formula | C15H24BNO3 |
|---|---|
| Molecular weight | 277.17 g/mol |
| IUPAC name | cyclopropyl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridin-1-yl]methanone |
| InChIKey | NYESTZADXNFZMS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CCN(CC2)C(=O)C3CC3 |
Computed by PubChem (NCBI)