cas: 59382-27-3 — see every product listed under this CAS number, including other names
Cyclopropyl[3-(trifluoromethyl)phenyl]methanamine 95% (CAS 59382-27-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A989566-100mg |
| cas | 59382-27-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 442.69 Pln | |
| Ambeed | 250mg | 670.75 Pln | |
| Ambeed | 1g | 1660.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A989566 |
Cyclopropyl-[3-(trifluoromethyl)phenyl]methanamine (CAS 59382-27-3) is a chemical compound with the molecular formula C11H12F3N and a molecular weight of 215.21 g/mol. IUPAC name: cyclopropyl-[3-(trifluoromethyl)phenyl]methanamine. InChIKey: NSVKYISBQIIXQE-UHFFFAOYSA-N.
| Molecular formula | C11H12F3N |
|---|---|
| Molecular weight | 215.21 g/mol |
| IUPAC name | cyclopropyl-[3-(trifluoromethyl)phenyl]methanamine |
| InChIKey | NSVKYISBQIIXQE-UHFFFAOYSA-N |
| SMILES | C1CC1C(C2=CC(=CC=C2)C(F)(F)F)N |
Computed by PubChem (NCBI)