Products 1504697-79-3

CAS 1504697-79-3 is the registry number for 3,3-Dimethyl-7-(trifluoromethyl)indoline, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 10g, 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

3,3-dimethyl-7-(trifluoromethyl)-1,2-dihydroindole (CAS 1504697-79-3) is a chemical compound with the molecular formula C11H12F3N and a molecular weight of 215.21 g/mol. IUPAC name: 3,3-dimethyl-7-(trifluoromethyl)-1,2-dihydroindole. InChIKey: GDUAIFBBMDMLAS-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12F3N
Molecular weight215.21 g/mol
IUPAC name3,3-dimethyl-7-(trifluoromethyl)-1,2-dihydroindole
InChIKeyGDUAIFBBMDMLAS-UHFFFAOYSA-N
SMILESCC1(CNC2=C1C=CC=C2C(F)(F)F)C

Computed by PubChem (NCBI)