cas: 72002-30-3 — see every product listed under this CAS number, including other names
D-6-Oxo-pipecolinic acid, 98.0% (CAS 72002-30-3) is a chemical reagent available from Chemat. Available pack sizes: 5 g, 10 g, 500 mg, 100 mg, 250 mg, 1 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W048995-5 g |
| cas | 72002-30-3 |
| size | 5 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 g | 1582.86 Pln | |
| MedChemExpress | 10 g | 2460.58 Pln | |
| MedChemExpress | 500 mg | 505.45 Pln | |
| MedChemExpress | 100 mg | 240.74 Pln | |
| MedChemExpress | 250 mg | 361.49 Pln | |
| MedChemExpress | 1 g | 719.08 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 98.0% |
(2R)-6-oxopiperidine-2-carboxylic acid (CAS 72002-30-3) is a chemical compound with the molecular formula C6H9NO3 and a molecular weight of 143.14 g/mol. IUPAC name: (2R)-6-oxopiperidine-2-carboxylic acid. InChIKey: FZXCPFJMYOQZCA-SCSAIBSYSA-N.
| Molecular formula | C6H9NO3 |
|---|---|
| Molecular weight | 143.14 g/mol |
| IUPAC name | (2R)-6-oxopiperidine-2-carboxylic acid |
| InChIKey | FZXCPFJMYOQZCA-SCSAIBSYSA-N |
| SMILES | C1C[C@@H](NC(=O)C1)C(=O)O |
Computed by PubChem (NCBI)