cas: 72002-30-3 — see every product listed under this CAS number, including other names
D-Pyrohomoglutamic Acid (CAS 72002-30-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg. Offered by: TargetMol.
| brand | TargetMol |
|---|---|
| catalog number | T71769-50mg |
| cas | 72002-30-3 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| TargetMol | 50mg | 983.72 Pln | |
| TargetMol | 100mg | 1601.41 Pln | |
| TargetMol | 250mg | 3274.50 Pln | |
| TargetMol | 500mg | 5579.26 Pln |
| purity | No data |
|---|---|
| delivery time | on request |
(2R)-6-oxopiperidine-2-carboxylic acid (CAS 72002-30-3) is a chemical compound with the molecular formula C6H9NO3 and a molecular weight of 143.14 g/mol. IUPAC name: (2R)-6-oxopiperidine-2-carboxylic acid. InChIKey: FZXCPFJMYOQZCA-SCSAIBSYSA-N.
| Molecular formula | C6H9NO3 |
|---|---|
| Molecular weight | 143.14 g/mol |
| IUPAC name | (2R)-6-oxopiperidine-2-carboxylic acid |
| InChIKey | FZXCPFJMYOQZCA-SCSAIBSYSA-N |
| SMILES | C1C[C@@H](NC(=O)C1)C(=O)O |
Computed by PubChem (NCBI)