cas: 76375-60-5 — see every product listed under this CAS number, including other names
D-Galactosamine pentaacetate, 98.0% (CAS 76375-60-5) is a chemical reagent available from Chemat. Available pack sizes: 100 g, 50 g, 25 g, 1 g, 5 g, 10 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-117271-100 g |
| cas | 76375-60-5 |
| size | 100 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 100 g | 1522.49 Pln | |
| MedChemExpress | 50 g | 997.72 Pln | |
| MedChemExpress | 25 g | 667.99 Pln | |
| MedChemExpress | 1 g | 240.74 Pln | |
| MedChemExpress | 5 g | 291.83 Pln | |
| MedChemExpress | 10 g | 394.00 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 98.0% |
[(2R,3R,4R,5R)-5-acetamido-3,4,6-triacetyloxyoxan-2-yl]methyl acetate (CAS 76375-60-5) is a chemical compound with the molecular formula C16H23NO10 and a molecular weight of 389.35 g/mol. IUPAC name: [(2R,3R,4R,5R)-5-acetamido-3,4,6-triacetyloxyoxan-2-yl]methyl acetate. InChIKey: OVPIZHVSWNOZMN-IWQYDBTJSA-N.
| Molecular formula | C16H23NO10 |
|---|---|
| Molecular weight | 389.35 g/mol |
| IUPAC name | [(2R,3R,4R,5R)-5-acetamido-3,4,6-triacetyloxyoxan-2-yl]methyl acetate |
| InChIKey | OVPIZHVSWNOZMN-IWQYDBTJSA-N |
| SMILES | CC(=O)N[C@@H]1[C@H]([C@H]([C@H](OC1OC(=O)C)COC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)