D-Gluconic acid, calcium salt (2:1), 98%, 98%
cas: 299-28-5 — see every product listed under this CAS number, including other names
D-Gluconic acid, calcium salt (2:1), 98%, 98% (CAS 299-28-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g, 250g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1132QX-10g |
| cas | 299-28-5 |
| size | 10g |
| availability | 3000g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 78.80 Pln | |
| Chemat | 100g | 83.60 Pln | |
| Chemat | 250g | 88.40 Pln | |
| Chemat | 500g | 168.00 Pln | |
| Chemat | 1kg | 256.40 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Calcium gluconate is the calcium salt of D-gluconic acid. It has a role as a nutraceutical. It contains a D-gluconate.
Source: ChEBI
| Molecular formula | C12H22CaO14 |
|---|---|
| Molecular weight | 430.37 g/mol |
| IUPAC name | calcium bis((2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate) |
| InChIKey | NEEHYRZPVYRGPP-IYEMJOQQSA-L |
| SMILES | C([C@H]([C@H]([C@@H]([C@H](C(=O)[O-])O)O)O)O)O.C([C@H]([C@H]([C@@H]([C@H](C(=O)[O-])O)O)O)O)O.[Ca+2] |
Computed by PubChem (NCBI)
Synonyms:
CALCIUM GLUCONATE, Calcium D-gluconate, Calcicol, Calglucon, Calciofon, Calcipur, Calglucol, Dragocal, Glucobiogen, Ebucin