CAS 18016-24-5 appears in our catalog under these names: Calcium Gluconate Monohydrate, 98%(T),RG, 98%(T),RG, D-Gluconic acid calcium salt monohydrate, min. 98,5 %, Ph. Eur., 500 g, plastic, D-Gluconic acid calcium salt monohydrate, min. 98,5 %, Ph. Eur., 1 kg, plastic, D-Gluconic acid calcium salt monohydrate, min. 98,5 %, Ph. Eur., 2.5 kg, plastic. Offered by: Chemat, Roth. Available pack sizes: 2.5kg, 25g, 100g, 500g, 1kg, 2,5kg.
Calcium bis(2,3,4,5,6-pentahydroxyhexanoate) (CAS 18016-24-5) is a chemical compound with the molecular formula C12H22CaO14 and a molecular weight of 430.37 g/mol. IUPAC name: calcium bis(2,3,4,5,6-pentahydroxyhexanoate). InChIKey: NEEHYRZPVYRGPP-UHFFFAOYSA-L.
| Molecular formula | C12H22CaO14 |
|---|---|
| Molecular weight | 430.37 g/mol |
| IUPAC name | calcium bis(2,3,4,5,6-pentahydroxyhexanoate) |
| InChIKey | NEEHYRZPVYRGPP-UHFFFAOYSA-L |
| SMILES | C(C(C(C(C(C(=O)[O-])O)O)O)O)O.C(C(C(C(C(C(=O)[O-])O)O)O)O)O.[Ca+2] |
Computed by PubChem (NCBI)