CAS 103404-75-7 appears in our catalog under these names: D-Luciferin Sodium/ 99.78% (existing batch purity), D-Luciferine sodium salt/ 99%, D–Luciferin (sodium salt), D-Luciferin sodium salt, 99.00%, D-Luciferin sodium salt. Offered by: TargetMol, Chemat, GLPBio, Biosynth, Thermo Scientific (Acros). Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 500mg, 250mg, 1g.
Sodium (4S)-2-(6-hydroxy-1,3-benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylate (CAS 103404-75-7) is a chemical compound with the molecular formula C11H7N2NaO3S2 and a molecular weight of 302.3 g/mol. IUPAC name: sodium (4S)-2-(6-hydroxy-1,3-benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylate. InChIKey: LILQLBIQROYWIA-OGFXRTJISA-M.
| Molecular formula | C11H7N2NaO3S2 |
|---|---|
| Molecular weight | 302.3 g/mol |
| IUPAC name | sodium (4S)-2-(6-hydroxy-1,3-benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylate |
| InChIKey | LILQLBIQROYWIA-OGFXRTJISA-M |
| SMILES | C1[C@@H](N=C(S1)C2=NC3=C(S2)C=C(C=C3)O)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)