CAS 3855-82-1 appears in our catalog under these names: 1,4-Dichlorobenzene-d4, 95%, 1,4-Dichlorobenzene-d4, >95% (HPLC), 1,4-Dichlorobenzene D4, 1,4-Dichlorobenzene D4 2000 µg/mL in Methanol, 1,4-Dichlorobenzene-d4, 98 atom % D, min 98% Chemical Purity. Offered by: Combi-blocks, TRC, Dr. Ehrenstorfer, CDN, GLPBio. Available pack sizes: 5g, 1g, 10g, 100mg, 1ml, 250mg, 1x10ml, 1x1ml.
1,4-dichloro-2,3,5,6-tetradeuteriobenzene (CAS 3855-82-1) is a chemical compound with the molecular formula C6H4Cl2 and a molecular weight of 151.02 g/mol. IUPAC name: 1,4-dichloro-2,3,5,6-tetradeuteriobenzene. InChIKey: OCJBOOLMMGQPQU-RHQRLBAQSA-N.
| Molecular formula | C6H4Cl2 |
|---|---|
| Molecular weight | 151.02 g/mol |
| IUPAC name | 1,4-dichloro-2,3,5,6-tetradeuteriobenzene |
| InChIKey | OCJBOOLMMGQPQU-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1Cl)[2H])[2H])Cl)[2H] |
Computed by PubChem (NCBI)