CAS 93951-78-1 appears in our catalog under these names: 2-Nitrophenol-d4, 2-Nitrophenol-3,4,5,6-d4, 2-Nitrophenol-3,4,5,6-d4, 98 atom % D, min 98% Chemical Purity, D4-2-Nitrophenol, D4-2-Nitrophenol, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: Chemat Brand, TRC, CDN, HPC Standards. Available pack sizes: on request, 2,5mg, 25mg, 5mg, 0,25g, 0,1g, 1x10mg, 1x1ml.
2,3,4,5-tetradeuterio-6-nitrophenol (CAS 93951-78-1) is a chemical compound with the molecular formula C6H5NO3 and a molecular weight of 143.13 g/mol. IUPAC name: 2,3,4,5-tetradeuterio-6-nitrophenol. InChIKey: IQUPABOKLQSFBK-RHQRLBAQSA-N.
| Molecular formula | C6H5NO3 |
|---|---|
| Molecular weight | 143.13 g/mol |
| IUPAC name | 2,3,4,5-tetradeuterio-6-nitrophenol |
| InChIKey | IQUPABOKLQSFBK-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[N+](=O)[O-])O)[2H])[2H] |
Computed by PubChem (NCBI)