CAS 1773496-62-0 appears in our catalog under these names: Triazophos-D5, >95% (HPLC), Triazophos D5 (phenyl D5), Triazophos-d5, D5-Triazophos, Concentration: 100 µg/ml Solvent: Acetonitrile, D5-Triazophos. Offered by: TRC, Dr. Ehrenstorfer, Biosynth, MedChemExpress, HPC Standards. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg, 5 mg, 10 mg, 1 mg.
Diethoxy-[[1-(2,3,4,5,6-pentadeuteriophenyl)-1,2,4-triazol-3-yl]oxy]-sulfanylidene-lambda5-phosphane (CAS 1773496-62-0) is a chemical compound with the molecular formula C12H16N3O3PS and a molecular weight of 318.35 g/mol. IUPAC name: diethoxy-[[1-(2,3,4,5,6-pentadeuteriophenyl)-1,2,4-triazol-3-yl]oxy]-sulfanylidene-lambda5-phosphane. InChIKey: AMFGTOFWMRQMEM-CFEWMVNUSA-N.
| Molecular formula | C12H16N3O3PS |
|---|---|
| Molecular weight | 318.35 g/mol |
| IUPAC name | diethoxy-[[1-(2,3,4,5,6-pentadeuteriophenyl)-1,2,4-triazol-3-yl]oxy]-sulfanylidene-lambda5-phosphane |
| InChIKey | AMFGTOFWMRQMEM-CFEWMVNUSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])N2C=NC(=N2)OP(=S)(OCC)OCC)[2H])[2H] |
Computed by PubChem (NCBI)