CAS 2543673-19-2 appears in our catalog under these names: DCC-3116/ 98.8% (existing batch purity), DCC–3116, DCC-3116, 99.67%, DCC-3116, 97%, 97%. Offered by: TargetMol, GLPBio, MedChemExpress, Chemat. Available pack sizes: 10mg, 50mg, 1mg, 5mg, 10mM (in 1ml dmso), 50 mg, 10mM/1mL, 500 mg.
4-[3-[[2-[2-ethyl-4-(4-methylpiperazin-1-yl)anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]-1,4-oxazepan-5-one (CAS 2543673-19-2) is a chemical compound with the molecular formula C26H36F3N7O2 and a molecular weight of 535.6 g/mol. IUPAC name: 4-[3-[[2-[2-ethyl-4-(4-methylpiperazin-1-yl)anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]-1,4-oxazepan-5-one. InChIKey: CNBTYICEJGEABG-UHFFFAOYSA-N.
| Molecular formula | C26H36F3N7O2 |
|---|---|
| Molecular weight | 535.6 g/mol |
| IUPAC name | 4-[3-[[2-[2-ethyl-4-(4-methylpiperazin-1-yl)anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]-1,4-oxazepan-5-one |
| InChIKey | CNBTYICEJGEABG-UHFFFAOYSA-N |
| SMILES | CCC1=C(C=CC(=C1)N2CCN(CC2)C)NC3=NC=C(C(=N3)NCCCN4CCOCCC4=O)C(F)(F)F |
Computed by PubChem (NCBI)