CAS 119555-47-4 appears in our catalog under these names: DDG-39/ 99.66% (existing batch purity), DDG-39, Ro 31-6840. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 1 mg, 10 mg.
4-amino-1-[(2R,3S,5S)-3-fluoro-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one (CAS 119555-47-4) is a chemical compound with the molecular formula C9H12FN3O3 and a molecular weight of 229.21 g/mol. IUPAC name: 4-amino-1-[(2R,3S,5S)-3-fluoro-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one. InChIKey: LTDCCBLBAQXNKP-VMHSAVOQSA-N.
| Molecular formula | C9H12FN3O3 |
|---|---|
| Molecular weight | 229.21 g/mol |
| IUPAC name | 4-amino-1-[(2R,3S,5S)-3-fluoro-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
| InChIKey | LTDCCBLBAQXNKP-VMHSAVOQSA-N |
| SMILES | C1[C@H](O[C@H]([C@H]1F)N2C=CC(=NC2=O)N)CO |
Computed by PubChem (NCBI)