CAS 2355377-13-6 appears in our catalog under these names: DDO–5936, DDO-5936/ 99.69% (existing batch purity), N-(Mesitylsulfonyl)-N-(4-((2-(pyrrolidin-1-yl)pyrimidin-4-yl)amino)phenyl)glycine, DDO-5936 98%, DDO-5936, 98%, 98%. Offered by: GLPBio, TargetMol, Biosynth, Ambeed, Chemat. Available pack sizes: 10mg, 25mg, 5mg, 50mg, 1mg, 100mg, 5 mg, 10mM/1mL.
2-[4-[(2-pyrrolidin-1-ylpyrimidin-4-yl)amino]-N-(2,4,6-trimethylphenyl)sulfonylanilino]acetic acid (CAS 2355377-13-6) is a chemical compound with the molecular formula C25H29N5O4S and a molecular weight of 495.6 g/mol. IUPAC name: 2-[4-[(2-pyrrolidin-1-ylpyrimidin-4-yl)amino]-N-(2,4,6-trimethylphenyl)sulfonylanilino]acetic acid. InChIKey: IIPYRKNROAWEPK-UHFFFAOYSA-N.
| Molecular formula | C25H29N5O4S |
|---|---|
| Molecular weight | 495.6 g/mol |
| IUPAC name | 2-[4-[(2-pyrrolidin-1-ylpyrimidin-4-yl)amino]-N-(2,4,6-trimethylphenyl)sulfonylanilino]acetic acid |
| InChIKey | IIPYRKNROAWEPK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)S(=O)(=O)N(CC(=O)O)C2=CC=C(C=C2)NC3=NC(=NC=C3)N4CCCC4)C |
Computed by PubChem (NCBI)