DELTA9-tetrahydrocannabinolic acid B (th
cas: 23978-84-9 — see every product listed under this CAS number, including other names
DELTA9-tetrahydrocannabinolic acid B (th (CAS 23978-84-9) is a chemical reagent available from Chemat. Available pack sizes: 1ML. Offered by: Supelco.
| brand | Supelco |
|---|---|
| catalog number | T-155-1ML |
| cas | 23978-84-9 |
| size | 1ML |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Supelco | 1ML | 970.00 Pln |
(6aR,10aR)-1-hydroxy-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromene-4-carboxylic acid (CAS 23978-84-9) is a chemical compound with the molecular formula C22H30O4 and a molecular weight of 358.5 g/mol. IUPAC name: (6aR,10aR)-1-hydroxy-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromene-4-carboxylic acid. InChIKey: VITZNDKHSIWPSR-HZPDHXFCSA-N.
| Molecular formula | C22H30O4 |
|---|---|
| Molecular weight | 358.5 g/mol |
| IUPAC name | (6aR,10aR)-1-hydroxy-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromene-4-carboxylic acid |
| InChIKey | VITZNDKHSIWPSR-HZPDHXFCSA-N |
| SMILES | CCCCCC1=CC(=C2[C@@H]3C=C(CC[C@H]3C(OC2=C1C(=O)O)(C)C)C)O |
Computed by PubChem (NCBI)
Synonyms:
Thca-b, delta1-Tetrahydrocannabinolic acid B, Cannabinolic acid B, delta9-Thca-C4 B, delta9-Tetrahydrocannabinoic acid B, delta-9-Tetrahydrocannabinolic acid-C4 B, 1delta9-Tetrahydrocannabinoic acid B, Tetrahydrocannabinol acid, delta-Tetrahydrocannabinolic acid B, TETRAHYDROCANNABINOIC ACID B