CAS 57905-07-4 is the registry number for Mifepristone Impurity 12. Offered by: Chemat Brand. Available pack sizes: on request.
CAS 57905-07-4 identifies a chemical compound with the molecular formula C22H30O4 and a molecular weight of 358.5 g/mol. InChIKey: VCJRIJKZDDFALD-AABGKKOBSA-N.
| Molecular formula | C22H30O4 |
|---|---|
| Molecular weight | 358.5 g/mol |
| InChIKey | VCJRIJKZDDFALD-AABGKKOBSA-N |
| SMILES | C[C@]12CC=C3[C@H]([C@@H]1CCC24OCCO4)CCC5=C3CCC6(C5)OCCO6 |
Computed by PubChem (NCBI)