CAS 2615911-12-9 appears in our catalog under these names: DEPTOR-IN-1/ 97.84% (existing batch purity), DEPTOR–IN–1, DEPTOR-IN-1, 99%, 99%, DEPTOR-IN-1, 98.13%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg.
2-(3,4-dichlorophenyl)-9-[(3-fluorophenyl)methyl]-3-hydroxy-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-4-one (CAS 2615911-12-9) is a chemical compound with the molecular formula C24H16Cl2FNO4 and a molecular weight of 472.3 g/mol. IUPAC name: 2-(3,4-dichlorophenyl)-9-[(3-fluorophenyl)methyl]-3-hydroxy-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-4-one. InChIKey: YHKREPOFPNSZAL-UHFFFAOYSA-N.
| Molecular formula | C24H16Cl2FNO4 |
|---|---|
| Molecular weight | 472.3 g/mol |
| IUPAC name | 2-(3,4-dichlorophenyl)-9-[(3-fluorophenyl)methyl]-3-hydroxy-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-4-one |
| InChIKey | YHKREPOFPNSZAL-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC3=C2OC(=C(C3=O)O)C4=CC(=C(C=C4)Cl)Cl)OCN1CC5=CC(=CC=C5)F |
Computed by PubChem (NCBI)