CAS 1361504-77-9 appears in our catalog under these names: DG–172 (hydrochloride), DG172 dihydrochloride/ 100%, DG 172 hydrochloride, (Z)-2-(2-Bromophenyl)-3-(4-(4-methylpiperazin-1-yl)phenyl)acrylonitrile dihydrochloride, ≥98%(HPLC), ≥98%(HPLC), DG172 (dihydrochloride), 99.51%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 2mg, 50mg, 100mg, 50 mg, 25 mg.
(Z)-2-(2-bromophenyl)-3-[4-(4-methylpiperazin-1-yl)phenyl]prop-2-enenitrile;dihydrochloride (CAS 1361504-77-9) is a chemical compound with the molecular formula C20H22BrCl2N3 and a molecular weight of 455.2 g/mol. IUPAC name: (Z)-2-(2-bromophenyl)-3-[4-(4-methylpiperazin-1-yl)phenyl]prop-2-enenitrile;dihydrochloride. InChIKey: SABUORLIDVBCPI-WTLOABTRSA-N.
| Molecular formula | C20H22BrCl2N3 |
|---|---|
| Molecular weight | 455.2 g/mol |
| IUPAC name | (Z)-2-(2-bromophenyl)-3-[4-(4-methylpiperazin-1-yl)phenyl]prop-2-enenitrile;dihydrochloride |
| InChIKey | SABUORLIDVBCPI-WTLOABTRSA-N |
| SMILES | CN1CCN(CC1)C2=CC=C(C=C2)/C=C(\C#N)/C3=CC=CC=C3Br.Cl.Cl |
Computed by PubChem (NCBI)