Products 942999-61-3
CAS 942999-61-3 appears in our catalog under these names: DGAT-1 inhibitor 2/ 98.27% (existing batch purity), DGAT1 Inhibitor 2, DGAT-1 inhibitor 2 (Standard), DGAT-1 inhibitor 2, 95.33%. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 2mg, Get quote.
2-[4-[4-(4-amino-7,7-dimethylpyrimido[4,5-b][1,4]oxazin-6-yl)phenyl]-1-bicyclo[2.2.2]octanyl]acetic acid (CAS 942999-61-3) is a chemical compound with the molecular formula C24H28N4O3 and a molecular weight of 420.5 g/mol. IUPAC name: 2-[4-[4-(4-amino-7,7-dimethylpyrimido[4,5-b][1,4]oxazin-6-yl)phenyl]-1-bicyclo[2.2.2]octanyl]acetic acid. InChIKey: VGPKUACRBMPJLF-UHFFFAOYSA-N.
| Molecular formula | C24H28N4O3 |
|---|---|
| Molecular weight | 420.5 g/mol |
| IUPAC name | 2-[4-[4-(4-amino-7,7-dimethylpyrimido[4,5-b][1,4]oxazin-6-yl)phenyl]-1-bicyclo[2.2.2]octanyl]acetic acid |
| InChIKey | VGPKUACRBMPJLF-UHFFFAOYSA-N |
| SMILES | CC1(C(=NC2=C(N=CN=C2O1)N)C3=CC=C(C=C3)C45CCC(CC4)(CC5)CC(=O)O)C |
Computed by PubChem (NCBI)