CAS 1800296-63-2 appears in our catalog under these names: DHODH-IN-1/ 99.56% (existing batch purity), DHODH–IN–1, DHODH-IN-1, DHODH-IN-1, 98.92%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 5 mg, 10 mg, 25 mg.
5-cyclopropyl-2-[4-(2,6-difluorophenoxy)-5-methyl-3-propan-2-yloxypyrazol-1-yl]-3-fluoropyridine (CAS 1800296-63-2) is a chemical compound with the molecular formula C21H20F3N3O2 and a molecular weight of 403.4 g/mol. IUPAC name: 5-cyclopropyl-2-[4-(2,6-difluorophenoxy)-5-methyl-3-propan-2-yloxypyrazol-1-yl]-3-fluoropyridine. InChIKey: JNAABFZPXJJMPX-UHFFFAOYSA-N.
| Molecular formula | C21H20F3N3O2 |
|---|---|
| Molecular weight | 403.4 g/mol |
| IUPAC name | 5-cyclopropyl-2-[4-(2,6-difluorophenoxy)-5-methyl-3-propan-2-yloxypyrazol-1-yl]-3-fluoropyridine |
| InChIKey | JNAABFZPXJJMPX-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C2=C(C=C(C=N2)C3CC3)F)OC(C)C)OC4=C(C=CC=C4F)F |
Computed by PubChem (NCBI)