CAS 1364791-93-4 appears in our catalog under these names: DHODH–IN–14, DHODH-IN-14/ 99.87% (existing batch purity), DHODH-IN-14, DHODH-IN-14, 99.81%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 2mg, 10mg, 25mg, 50mg, 100mg, 1 mg.
4-oxo-N-(2,3,5,6-tetrafluoro-4-phenylphenyl)-1,2,5-oxadiazole-3-carboxamide (CAS 1364791-93-4) is a chemical compound with the molecular formula C15H7F4N3O3 and a molecular weight of 353.23 g/mol. IUPAC name: 4-oxo-N-(2,3,5,6-tetrafluoro-4-phenylphenyl)-1,2,5-oxadiazole-3-carboxamide. InChIKey: AMBZERWHSFYQLK-UHFFFAOYSA-N.
| Molecular formula | C15H7F4N3O3 |
|---|---|
| Molecular weight | 353.23 g/mol |
| IUPAC name | 4-oxo-N-(2,3,5,6-tetrafluoro-4-phenylphenyl)-1,2,5-oxadiazole-3-carboxamide |
| InChIKey | AMBZERWHSFYQLK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C(=C(C(=C2F)F)NC(=O)C3=NONC3=O)F)F |
Computed by PubChem (NCBI)