CAS 1346705-53-0 appears in our catalog under these names: DHODH-IN-23/ 98.1% (existing batch purity), DHODH–IN–23, 2-[[(3′-Butoxy-3-chloro-5-fluoro[1,1′-biphenyl]-4-yl)amino]carbonyl]benzoic acid, 95%, 95%, DHODH-IN-23, 98.75%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 25 mg, 50 mg, 100 mg.
2-[[4-(3-butoxyphenyl)-2-chloro-6-fluorophenyl]carbamoyl]benzoic acid (CAS 1346705-53-0) is a chemical compound with the molecular formula C24H21ClFNO4 and a molecular weight of 441.9 g/mol. IUPAC name: 2-[[4-(3-butoxyphenyl)-2-chloro-6-fluorophenyl]carbamoyl]benzoic acid. InChIKey: YETZVOVKXKTYRX-UHFFFAOYSA-N.
| Molecular formula | C24H21ClFNO4 |
|---|---|
| Molecular weight | 441.9 g/mol |
| IUPAC name | 2-[[4-(3-butoxyphenyl)-2-chloro-6-fluorophenyl]carbamoyl]benzoic acid |
| InChIKey | YETZVOVKXKTYRX-UHFFFAOYSA-N |
| SMILES | CCCCOC1=CC=CC(=C1)C2=CC(=C(C(=C2)Cl)NC(=O)C3=CC=CC=C3C(=O)O)F |
Computed by PubChem (NCBI)