CAS 2973395-71-8 appears in our catalog under these names: DHX9-IN-2, 98%, DHX9-IN-2/ 98%, DHX9–IN–2, DHX9-IN-2 97%, N-(3-Chloro-5-(methylsulfonamido)phenyl)-4-(3-methylpyridin-2-yl)thiophene-2-carboxamide. Offered by: AmBeed, TargetMol, GLPBio, Chemat. Available pack sizes: 5mg, 10mg, 1mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 250mg.
N-[3-chloro-5-(methanesulfonamido)phenyl]-4-(3-methyl-2-pyridinyl)thiophene-2-carboxamide (CAS 2973395-71-8) is a chemical compound with the molecular formula C18H16ClN3O3S2 and a molecular weight of 421.9 g/mol. IUPAC name: N-[3-chloro-5-(methanesulfonamido)phenyl]-4-(3-methyl-2-pyridinyl)thiophene-2-carboxamide. InChIKey: VDGNPEFFHQRGOP-UHFFFAOYSA-N.
| Molecular formula | C18H16ClN3O3S2 |
|---|---|
| Molecular weight | 421.9 g/mol |
| IUPAC name | N-[3-chloro-5-(methanesulfonamido)phenyl]-4-(3-methyl-2-pyridinyl)thiophene-2-carboxamide |
| InChIKey | VDGNPEFFHQRGOP-UHFFFAOYSA-N |
| SMILES | CC1=C(N=CC=C1)C2=CSC(=C2)C(=O)NC3=CC(=CC(=C3)Cl)NS(=O)(=O)C |
Computed by PubChem (NCBI)