cas: 67483-13-0 — see every product listed under this CAS number, including other names
DIDS sodium salt 98% (CAS 67483-13-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1353275-1g |
| cas | 67483-13-0 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 3023.69 Pln | |
| Ambeed | 5mg | 181.25 Pln | |
| Ambeed | 10mg | 220.19 Pln | |
| Ambeed | 25mg | 320.31 Pln | |
| Ambeed | 50mg | 375.94 Pln | |
| Ambeed | 100mg | 598.44 Pln | |
| Ambeed | 250mg | 993.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1353275 |
Disodium;5-isothiocyanato-2-[(E)-2-(4-isothiocyanato-2-sulfonatophenyl)ethenyl]benzenesulfonate (CAS 67483-13-0) is a chemical compound with the molecular formula C16H8N2Na2O6S4 and a molecular weight of 498.5 g/mol. IUPAC name: disodium;5-isothiocyanato-2-[(E)-2-(4-isothiocyanato-2-sulfonatophenyl)ethenyl]benzenesulfonate. InChIKey: GEPAYBXVXXBSKP-SEPHDYHBSA-L.
| Molecular formula | C16H8N2Na2O6S4 |
|---|---|
| Molecular weight | 498.5 g/mol |
| IUPAC name | disodium;5-isothiocyanato-2-[(E)-2-(4-isothiocyanato-2-sulfonatophenyl)ethenyl]benzenesulfonate |
| InChIKey | GEPAYBXVXXBSKP-SEPHDYHBSA-L |
| SMILES | C1=CC(=C(C=C1N=C=S)S(=O)(=O)[O-])/C=C/C2=C(C=C(C=C2)N=C=S)S(=O)(=O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)