CAS 67483-13-0 appears in our catalog under these names: 4,4'-Diisothiocyano-2,2'-stilbenedisulfonic Acid, Disodium Salt, >95% (HPLC), DIDS sodium salt/ 96.5% (existing batch purity), DIDS sodium salt, Disodium 4,4'-Diisothiocyanato-2,2'-stilbenedisulfonate, >90.0%(HPLC)(N), DIDS sodium salt 98%. Offered by: TRC, TargetMol, GLPBio, TCI, Ambeed. Available pack sizes: 100mg, 250mg, 25mg, 10mg, 10mM (in 1ml dmso), 50mg, 1g, 5mg.
Disodium;5-isothiocyanato-2-[(E)-2-(4-isothiocyanato-2-sulfonatophenyl)ethenyl]benzenesulfonate (CAS 67483-13-0) is a chemical compound with the molecular formula C16H8N2Na2O6S4 and a molecular weight of 498.5 g/mol. IUPAC name: disodium;5-isothiocyanato-2-[(E)-2-(4-isothiocyanato-2-sulfonatophenyl)ethenyl]benzenesulfonate. InChIKey: GEPAYBXVXXBSKP-SEPHDYHBSA-L.
| Molecular formula | C16H8N2Na2O6S4 |
|---|---|
| Molecular weight | 498.5 g/mol |
| IUPAC name | disodium;5-isothiocyanato-2-[(E)-2-(4-isothiocyanato-2-sulfonatophenyl)ethenyl]benzenesulfonate |
| InChIKey | GEPAYBXVXXBSKP-SEPHDYHBSA-L |
| SMILES | C1=CC(=C(C=C1N=C=S)S(=O)(=O)[O-])/C=C/C2=C(C=C(C=C2)N=C=S)S(=O)(=O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)