cas: 79642-50-5 — see every product listed under this CAS number, including other names
DISUCCINIMIDYL GLUTARATE, 97%, 97% (CAS 79642-50-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11625X-100mg |
| cas | 79642-50-5 |
| size | 100mg |
| availability | 5000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 131.60 Pln | |
| Chemat | 5g | 270.80 Pln | |
| Chemat | 10g | 371.60 Pln | |
| Chemat | 25g | 650.00 Pln | |
| Chemat | 50g | 856.40 Pln | |
| Chemat | 100g | 1370.00 Pln | |
| Chemat | 10mg | 78.80 Pln | |
| Chemat | 250g | 2747.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Bis(2,5-dioxopyrrolidin-1-yl) pentanedioate (CAS 79642-50-5) is a chemical compound with the molecular formula C13H14N2O8 and a molecular weight of 326.26 g/mol. IUPAC name: bis(2,5-dioxopyrrolidin-1-yl) pentanedioate. InChIKey: LNQHREYHFRFJAU-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O8 |
|---|---|
| Molecular weight | 326.26 g/mol |
| IUPAC name | bis(2,5-dioxopyrrolidin-1-yl) pentanedioate |
| InChIKey | LNQHREYHFRFJAU-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCCC(=O)ON2C(=O)CCC2=O |
Computed by PubChem (NCBI)