cas: 79642-50-5 — see every product listed under this CAS number, including other names
DISUCCINIMIDYL GLUTARATE, 95% (CAS 79642-50-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 50mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F500305-100MG |
| cas | 79642-50-5 |
| size | 100mg |
| availability | In Stock Germany |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 102.07 Pln | |
| Fluorochem | 50mg | 102.07 Pln | |
| Fluorochem | 250mg | 122.89 Pln | |
| Fluorochem | 1g | 216.61 Pln | |
| Fluorochem | 5g | 341.56 Pln | |
| Fluorochem | 10g | 508.17 Pln | |
| Fluorochem | 25g | 893.45 Pln | |
| Fluorochem | 100g | 2304.41 Pln |
| purity | 95,00% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
Bis(2,5-dioxopyrrolidin-1-yl) pentanedioate (CAS 79642-50-5) is a chemical compound with the molecular formula C13H14N2O8 and a molecular weight of 326.26 g/mol. IUPAC name: bis(2,5-dioxopyrrolidin-1-yl) pentanedioate. InChIKey: LNQHREYHFRFJAU-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O8 |
|---|---|
| Molecular weight | 326.26 g/mol |
| IUPAC name | bis(2,5-dioxopyrrolidin-1-yl) pentanedioate |
| InChIKey | LNQHREYHFRFJAU-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCCC(=O)ON2C(=O)CCC2=O |
Computed by PubChem (NCBI)