cas: 74444-77-2 — see every product listed under this CAS number, including other names
DL-2-Aminotetralin-2-carboxylic acid, 97% (CAS 74444-77-2) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F300565-500MG |
| cas | 74444-77-2 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 1637.98 Pln | |
| Fluorochem | 1g | 2413.75 Pln | |
| Fluorochem | 5g | 6001.03 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-amino-3,4-dihydro-1H-naphthalene-2-carboxylic acid (CAS 74444-77-2) is a chemical compound with the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. IUPAC name: 2-amino-3,4-dihydro-1H-naphthalene-2-carboxylic acid. InChIKey: CDULPPOISZOUTK-UHFFFAOYSA-N.
| Molecular formula | C11H13NO2 |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | 2-amino-3,4-dihydro-1H-naphthalene-2-carboxylic acid |
| InChIKey | CDULPPOISZOUTK-UHFFFAOYSA-N |
| SMILES | C1CC(CC2=CC=CC=C21)(C(=O)O)N |
Computed by PubChem (NCBI)