cas: 144476-54-0 — see every product listed under this CAS number, including other names
DL-Alanine-¹³C₃, ≥99 atom% 13C,≥99%(CP), ≥99 atom% 13C,≥99%(CP) (CAS 144476-54-0) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 25mg, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112JLU-5mg |
| cas | 144476-54-0 |
| size | 5mg |
| availability | 0.2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5mg | 851.60 Pln | |
| Chemat | 25mg | 1902.80 Pln | |
| Chemat | 100mg | 5574.80 Pln |
| purity | ≥99 atom% 13C,≥99%(CP) |
|---|---|
| delivery time | 3 weeks |
2-amino(1,2,3-13C3)propanoic acid (CAS 144476-54-0) is a chemical compound with the molecular formula C3H7NO2 and a molecular weight of 92.072 g/mol. IUPAC name: 2-amino(1,2,3-13C3)propanoic acid. InChIKey: QNAYBMKLOCPYGJ-VMIGTVKRSA-N.
| Molecular formula | C3H7NO2 |
|---|---|
| Molecular weight | 92.072 g/mol |
| IUPAC name | 2-amino(1,2,3-13C3)propanoic acid |
| InChIKey | QNAYBMKLOCPYGJ-VMIGTVKRSA-N |
| SMILES | [13CH3][13CH]([13C](=O)O)N |
Computed by PubChem (NCBI)