CAS 53795-94-1 appears in our catalog under these names: DL-Alanine-3,3,3-d3, DL-Alanine-3,3,3-d3, 99 atom % D, min 98% Chemical Purity, DL–Alanine–3,3,3–d3, DL-ALANINE-3,3,3-D3, 99.5 ATOM % D, DL-Alanine-d3, 98.0%. Offered by: Chemat Brand, CDN, GLPBio, Sigma-Aldrich, MedChemExpress. Available pack sizes: on request, 1g, 0,5g, 10mg, 5mg, 50 mg, 10 mg, 250 mg.
2-amino-3,3,3-trideuteriopropanoic acid (CAS 53795-94-1) is a chemical compound with the molecular formula C3H7NO2 and a molecular weight of 92.11 g/mol. IUPAC name: 2-amino-3,3,3-trideuteriopropanoic acid. InChIKey: QNAYBMKLOCPYGJ-FIBGUPNXSA-N.
| Molecular formula | C3H7NO2 |
|---|---|
| Molecular weight | 92.11 g/mol |
| IUPAC name | 2-amino-3,3,3-trideuteriopropanoic acid |
| InChIKey | QNAYBMKLOCPYGJ-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C(C(=O)O)N |
Computed by PubChem (NCBI)